74541 -OEChem-03010813432D 17 17 0 0 0 0 0 0 0999 V2000 -1.8730 0.8804 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1.1779 0.0234 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 0.8679 0.7644 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 0.5861 1.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5413 1.0462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1779 1.3964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3099 -0.3390 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 -1.6786 -1.4344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6780 -0.7045 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0 0.2319 0.3984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0360 -0.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0360 0.3984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4020 0.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2319 -0.3345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4020 -0.7005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1220 0.6038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9062 1.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 12 1 0 0 0 0 2 3 2 0 0 0 0 3 4 1 0 0 0 0 3 5 1 0 0 0 0 3 6 1 0 0 0 0 4 10 1 0 0 0 0 5 16 1 0 0 0 0 6 17 1 0 0 0 0 7 9 1 0 0 0 0 8 9 2 0 0 0 0 9 11 1 0 0 0 0 10 13 2 0 0 0 0 10 14 1 0 0 0 0 11 12 2 0 0 0 0 11 15 1 0 0 0 0 12 13 1 0 0 0 0 14 15 2 0 0 0 0 M CHG 2 7 -1 9 1 M END > 0 > 0 > 74541 > 2 > DTP/NCI > 8927 > DTP/NCI from molfile. Release-June 2007. Structure Evaluation:Consistent with Molecular Formula. Deposition record created from database webdb on host dtpiv1.ncifcrf.gov on Feb 22, 2008 > 500-28-7 BAY 22190 Bayer 22/190 Chloorthion Chlorothion Chlorthion Chlorthion methyl Chlortion Compound 22/190 Dimethyl 3-chloro-4-nitrophenyl thionophosphate Ent 18,861 Methyl chlorothion NSC8927 O,O-Dimethyl O-(3-chloro-4-nitrophenyl) phosphorothioate O,O-Dimethyl O-(3-chloro-4-nitrophenyl) thiophosphate O,O-Dimethyl O-4-nitro-3-chlorophenyl thiophosphate O,O-Dimethyl p-nitro-m-chlorophenyl thiophosphate O,O-Dimethyl-O-(3-chlor-4-nitrophenyl)-monothiophosphat O,O-Dimethyl-O-3-chlor-4-nitrofenyltiofosfat O-(3-Chlor-4-nitro-phenyl)-O,O-dimethyl-monothiophosphat O-(3-Chloro-4-nitro-fenyl)-O,O-dimethyl-monothiofosfaat O-(3-Chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate O-(3-Cloro-4-nitro-fenil)-O,O-dimetil-monotiofosfato OMS 217 Phenol, 3-chloro-4-nitro-, 0-ester with 0,0-dimethyl phosphorothioate Phosphorothioic acid, O-(3-chloro-4-nitrophenyl) O,O-dimethyl ester Thiophosphate de O,O-dimethyle et de O-3-chloro-4-nitrophenyle WLN: WNR BG DOPS&O1&O1 p-Nitro-m-chlorophenyl dimethyl thionophosphate > 500-28-7 > 8927 > http://dtp.nci.nih.gov/ > http://dtp.nci.nih.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8927 > 10372 1 $$$$